C41H50ClN9O5 — CID 166948066
3-[4-[3-[4-[1-[4-[[5-chloro-4-[2-(methylamino)anilino]pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazin-1-yl]propoxy]phenoxy]piperidine-2,6-dione (PubChem CID 166948066) has the molecular formula C41H50ClN9O5 and a molecular weight of 784.36 g/mol. Its IUPAC name is 3-[4-[3-[4-[1-[4-[[5-chloro-4-[2-(methylamino)anilino]pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazin-1-yl]propoxy]phenoxy]piperidine-2,6-dione.
| Compound Name | 3-[4-[3-[4-[1-[4-[[5-chloro-4-[2-(methylamino)anilino]pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazin-1-yl]propoxy]phenoxy]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166948066 |
| Molecular Formula | C41H50ClN9O5 |
| Molecular Weight | 784.36 g/mol |
| Exact Mass | 783.36 |
| IUPAC Name | 3-[4-[3-[4-[1-[4-[[5-chloro-4-[2-(methylamino)anilino]pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazin-1-yl]propoxy]phenoxy]piperidine-2,6-dione |
| SMILES | CNc1ccccc1Nc1nc(Nc2ccc(N3CCC(N4CCN(CCCOc5ccc(OC6CCC(=O)NC6=O)cc5)CC4)CC3)cc2OC)ncc1Cl |
| InChI | InChI=1S/C41H50ClN9O5/c1-43-33-6-3-4-7-34(33)45-39-32(42)27-44-41(48-39)46-35-13-8-29(26-37(35)54-2)50-19-16-28(17-20-50)51-23-21-49(22-24-51)18-5-25-55-30-9-11-31(12-10-30)56-36-14-15-38(52)47-40(36)53/h3-4,6-13,26-28,36,43H,5,14-25H2,1-2H3,(H,47,52,53)(H2,44,45,46,48) |
| InChIKey | CKJZFGFQYGSZQO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.36 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|