C13H27NO5 — CID 166948238
5-amino-2-(hydroxymethyl)-6-(2-methoxypropan-2-yl)-3-propan-2-yloxyoxan-4-ol (PubChem CID 166948238) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is 5-amino-2-(hydroxymethyl)-6-(2-methoxypropan-2-yl)-3-propan-2-yloxyoxan-4-ol.
| Compound Name | 5-amino-2-(hydroxymethyl)-6-(2-methoxypropan-2-yl)-3-propan-2-yloxyoxan-4-ol |
|---|---|
| PubChem CID | 166948238 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 5-amino-2-(hydroxymethyl)-6-(2-methoxypropan-2-yl)-3-propan-2-yloxyoxan-4-ol |
| SMILES | COC(C)(C)C1OC(CO)C(OC(C)C)C(O)C1N |
| InChI | InChI=1S/C13H27NO5/c1-7(2)18-11-8(6-15)19-12(9(14)10(11)16)13(3,4)17-5/h7-12,15-16H,6,14H2,1-5H3 |
| InChIKey | XZWBNSYYVYHXMW-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |