C51H49ClN2S — CID 166949997
N,N-bis(4-tert-butylphenyl)-2-chloro-3-(5,5-diphenylphenothiazin-10-yl)-5-methylaniline (PubChem CID 166949997) has the molecular formula C51H49ClN2S and a molecular weight of 757.49 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-2-chloro-3-(5,5-diphenylphenothiazin-10-yl)-5-methylaniline.
| Compound Name | N,N-bis(4-tert-butylphenyl)-2-chloro-3-(5,5-diphenylphenothiazin-10-yl)-5-methylaniline |
|---|---|
| PubChem CID | 166949997 |
| Molecular Formula | C51H49ClN2S |
| Molecular Weight | 757.49 g/mol |
| Exact Mass | 756.33 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-2-chloro-3-(5,5-diphenylphenothiazin-10-yl)-5-methylaniline |
| SMILES | Cc1cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c(Cl)c(N2c3ccccc3S(c3ccccc3)(c3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C51H49ClN2S/c1-36-34-45(53(39-30-26-37(27-31-39)50(2,3)4)40-32-28-38(29-33-40)51(5,6)7)49(52)46(35-36)54-43-22-14-16-24-47(43)55(41-18-10-8-11-19-41,42-20-12-9-13-21-42)48-25-17-15-23-44(48)54/h8-35H,1-7H3 |
| InChIKey | VCDJQONOINSKBV-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.49 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |