About 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole
2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole (PubChem CID 166953933) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole.
Analyze 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole?
The IUPAC name of 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole (CID 166953933) is 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole.
What is the SMILES notation for 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole?
The canonical SMILES for 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole is CC1=NC(=C(C)C)CC1.
What is the InChIKey of 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole?
The InChIKey is FZRUURDNADNRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-6(2)8-5-4-7(3)9-8/h4-5H2,1-3H3.
What are the key properties of 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole?
2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole has a molecular weight of 123.20 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-propan-2-ylidene-3,4-dihydropyrrole is sourced from PubChem (CID 166953933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).