C17H21N5O2S — CID 166955537
2-amino-N-[5-(4-ethenylsulfanylpiperazin-1-yl)-2-methylphenyl]-1,3-oxazole-4-carboxamide (PubChem CID 166955537) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-amino-N-[5-(4-ethenylsulfanylpiperazin-1-yl)-2-methylphenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-amino-N-[5-(4-ethenylsulfanylpiperazin-1-yl)-2-methylphenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166955537 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-amino-N-[5-(4-ethenylsulfanylpiperazin-1-yl)-2-methylphenyl]-1,3-oxazole-4-carboxamide |
| SMILES | C=CSN1CCN(c2ccc(C)c(NC(=O)c3coc(N)n3)c2)CC1 |
| InChI | InChI=1S/C17H21N5O2S/c1-3-25-22-8-6-21(7-9-22)13-5-4-12(2)14(10-13)19-16(23)15-11-24-17(18)20-15/h3-5,10-11H,1,6-9H2,2H3,(H2,18,20)(H,19,23) |
| InChIKey | CXGJQAVUCAGWIW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|