C15H19BBrN5O3 — CID 153280788
[4-[3-[(2-amino-1,3-oxazole-4-carbonyl)amino]-4-bromophenyl]piperazin-1-yl]-methylborinic acid (PubChem CID 153280788) has the molecular formula C15H19BBrN5O3 and a molecular weight of 408.07 g/mol. Its IUPAC name is [4-[3-[(2-amino-1,3-oxazole-4-carbonyl)amino]-4-bromophenyl]piperazin-1-yl]-methylborinic acid.
| Compound Name | [4-[3-[(2-amino-1,3-oxazole-4-carbonyl)amino]-4-bromophenyl]piperazin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 153280788 |
| Molecular Formula | C15H19BBrN5O3 |
| Molecular Weight | 408.07 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [4-[3-[(2-amino-1,3-oxazole-4-carbonyl)amino]-4-bromophenyl]piperazin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCN(c2ccc(Br)c(NC(=O)c3coc(N)n3)c2)CC1 |
| InChI | InChI=1S/C15H19BBrN5O3/c1-16(24)22-6-4-21(5-7-22)10-2-3-11(17)12(8-10)19-14(23)13-9-25-15(18)20-13/h2-3,8-9,24H,4-7H2,1H3,(H2,18,20)(H,19,23) |
| InChIKey | FDRVPIDRRMEMHR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.07 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|