C22H28BrN5O — CID 151398245
6-bromo-N-[4-(4-methylpiperazin-1-yl)-2-piperidin-1-ylphenyl]pyridine-2-carboxamide (PubChem CID 151398245) has the molecular formula C22H28BrN5O and a molecular weight of 458.40 g/mol. Its IUPAC name is 6-bromo-N-[4-(4-methylpiperazin-1-yl)-2-piperidin-1-ylphenyl]pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[4-(4-methylpiperazin-1-yl)-2-piperidin-1-ylphenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 151398245 |
| Molecular Formula | C22H28BrN5O |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 6-bromo-N-[4-(4-methylpiperazin-1-yl)-2-piperidin-1-ylphenyl]pyridine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cccc(Br)n3)c(N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C22H28BrN5O/c1-26-12-14-27(15-13-26)17-8-9-18(20(16-17)28-10-3-2-4-11-28)25-22(29)19-6-5-7-21(23)24-19/h5-9,16H,2-4,10-15H2,1H3,(H,25,29) |
| InChIKey | OVXSVCAXZRVSSO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|