C17H22N4O — CID 78904439
1,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)pyrazole-3-carboxamide (PubChem CID 78904439) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)pyrazole-3-carboxamide.
| Compound Name | 1,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 78904439 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)c1cc(C)n(C)n1 |
| InChI | InChI=1S/C17H22N4O/c1-12-10-14(21-8-4-5-9-21)6-7-15(12)18-17(22)16-11-13(2)20(3)19-16/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,18,22) |
| InChIKey | OJEZJQMOOSQLAZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|