C18H22N2O2 — CID 42038603
2,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)furan-3-carboxamide (PubChem CID 42038603) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 42038603 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N3CCCC3)cc2C)c(C)o1 |
| InChI | InChI=1S/C18H22N2O2/c1-12-10-15(20-8-4-5-9-20)6-7-17(12)19-18(21)16-11-13(2)22-14(16)3/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,19,21) |
| InChIKey | UFBZLRFVNGRZHU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|