C15H20N2O — CID 97305240
(Z)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)but-2-enamide (PubChem CID 97305240) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (Z)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)but-2-enamide.
| Compound Name | (Z)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 97305240 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (Z)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)but-2-enamide |
| SMILES | C/C=C\C(=O)Nc1ccc(N2CCCC2)cc1C |
| InChI | InChI=1S/C15H20N2O/c1-3-6-15(18)16-14-8-7-13(11-12(14)2)17-9-4-5-10-17/h3,6-8,11H,4-5,9-10H2,1-2H3,(H,16,18)/b6-3- |
| InChIKey | WNRNAJHOCUPHCT-UTCJRWHESA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|