C45H42N2O — CID 166957119
N-(3-bicyclo[4.1.0]hepta-1,3-dienyl)-4a-methyl-N-[4-[9-(4-methylphenyl)-1,2,4b,7,8,8a-hexahydrocarbazol-3-yl]phenyl]-9bH-dibenzofuran-1-amine (PubChem CID 166957119) has the molecular formula C45H42N2O and a molecular weight of 626.84 g/mol. Its IUPAC name is N-(3-bicyclo[4.1.0]hepta-1,3-dienyl)-4a-methyl-N-[4-[9-(4-methylphenyl)-1,2,4b,7,8,8a-hexahydrocarbazol-3-yl]phenyl]-9bH-dibenzofuran-1-amine.
| Compound Name | N-(3-bicyclo[4.1.0]hepta-1,3-dienyl)-4a-methyl-N-[4-[9-(4-methylphenyl)-1,2,4b,7,8,8a-hexahydrocarbazol-3-yl]phenyl]-9bH-dibenzofuran-1-amine |
|---|---|
| PubChem CID | 166957119 |
| Molecular Formula | C45H42N2O |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | N-(3-bicyclo[4.1.0]hepta-1,3-dienyl)-4a-methyl-N-[4-[9-(4-methylphenyl)-1,2,4b,7,8,8a-hexahydrocarbazol-3-yl]phenyl]-9bH-dibenzofuran-1-amine |
| SMILES | Cc1ccc(N2C3=C(C=C(c4ccc(N(C5=CCC6CC6=C5)C5=CC=CC6(C)Oc7ccccc7C56)cc4)CC3)C3C=CCCC32)cc1 |
| InChI | InChI=1S/C45H42N2O/c1-29-13-19-35(20-14-29)47-40-10-5-3-8-37(40)39-28-32(18-24-41(39)47)30-15-21-34(22-16-30)46(36-23-17-31-26-33(31)27-36)42-11-7-25-45(2)44(42)38-9-4-6-12-43(38)48-45/h3-4,6-9,11-16,19-23,25,27-28,31,37,40,44H,5,10,17-18,24,26H2,1-2H3 |
| InChIKey | FZWYRYGCYFZXSG-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|