C48H54N2 — CID 138625862
3-cyclohexa-1,3-dien-1-yl-9-(3-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-6-(9-cyclohex-2-en-1-yl-1,2,4b,7,8,8a-hexahydrocarbazol-3-yl)-1,2,3,4-tetrahydrocarbazole (PubChem CID 138625862) has the molecular formula C48H54N2 and a molecular weight of 658.97 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-yl-9-(3-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-6-(9-cyclohex-2-en-1-yl-1,2,4b,7,8,8a-hexahydrocarbazol-3-yl)-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 3-cyclohexa-1,3-dien-1-yl-9-(3-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-6-(9-cyclohex-2-en-1-yl-1,2,4b,7,8,8a-hexahydrocarbazol-3-yl)-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 138625862 |
| Molecular Formula | C48H54N2 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.43 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-yl-9-(3-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-6-(9-cyclohex-2-en-1-yl-1,2,4b,7,8,8a-hexahydrocarbazol-3-yl)-1,2,3,4-tetrahydrocarbazole |
| SMILES | C1=CCCC(C2CCc3c(c4cc(C5=CC6=C(CC5)N(C5C=CCCC5)C5CCC=CC65)ccc4n3C3=CC(C4C=CC=CC4)CCC3)C2)=C1 |
| InChI | InChI=1S/C48H54N2/c1-4-13-33(14-5-1)35-17-12-20-40(29-35)50-47-26-23-36(34-15-6-2-7-16-34)30-43(47)44-32-38(25-28-48(44)50)37-24-27-46-42(31-37)41-21-10-11-22-45(41)49(46)39-18-8-3-9-19-39/h1-2,4-6,8,10,13,15,18,21,25,28-29,31-33,35-36,39,41,45H,3,7,9,11-12,14,16-17,19-20,22-24,26-27,30H2 |
| InChIKey | VKVGYBJLWBYARB-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|