C42H52N6 — CID 165020970
2,4-di(cyclohexa-1,3-dien-1-yl)-6-[5-[3-(4-cyclohex-2-en-1-yl-6-phenyl-1,3,5-triazinan-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-1,5-dien-1-yl]-1,3,5-triazinane (PubChem CID 165020970) has the molecular formula C42H52N6 and a molecular weight of 640.92 g/mol. Its IUPAC name is 2,4-di(cyclohexa-1,3-dien-1-yl)-6-[5-[3-(4-cyclohex-2-en-1-yl-6-phenyl-1,3,5-triazinan-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-1,5-dien-1-yl]-1,3,5-triazinane.
| Compound Name | 2,4-di(cyclohexa-1,3-dien-1-yl)-6-[5-[3-(4-cyclohex-2-en-1-yl-6-phenyl-1,3,5-triazinan-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-1,5-dien-1-yl]-1,3,5-triazinane |
|---|---|
| PubChem CID | 165020970 |
| Molecular Formula | C42H52N6 |
| Molecular Weight | 640.92 g/mol |
| Exact Mass | 640.43 |
| IUPAC Name | 2,4-di(cyclohexa-1,3-dien-1-yl)-6-[5-[3-(4-cyclohex-2-en-1-yl-6-phenyl-1,3,5-triazinan-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-1,5-dien-1-yl]-1,3,5-triazinane |
| SMILES | C1=CCCC(C2NC(C3=CCCC(C4=CC(C5NC(c6ccccc6)NC(C6C=CCCC6)N5)CC=C4)=C3)NC(C3=CC=CCC3)N2)=C1 |
| InChI | InChI=1S/C42H52N6/c1-5-15-29(16-6-1)37-43-38(30-17-7-2-8-18-30)46-41(45-37)35-25-13-23-33(27-35)34-24-14-26-36(28-34)42-47-39(31-19-9-3-10-20-31)44-40(48-42)32-21-11-4-12-22-32/h1-3,5,7,9-11,14-15,17,19-21,24-25,27-28,32,36-48H,4,6,8,12-13,16,18,22-23,26H2 |
| InChIKey | UMFKHVPONZDCJI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.92 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|