C39H41N3 — CID 170065918
4-[5-(4a,7,8,12,12a,12b-hexahydrotriphenylen-2-yl)cyclohexa-2,4-dien-1-yl]-2-cyclohex-2-en-1-yl-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 170065918) has the molecular formula C39H41N3 and a molecular weight of 551.78 g/mol. Its IUPAC name is 4-[5-(4a,7,8,12,12a,12b-hexahydrotriphenylen-2-yl)cyclohexa-2,4-dien-1-yl]-2-cyclohex-2-en-1-yl-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 4-[5-(4a,7,8,12,12a,12b-hexahydrotriphenylen-2-yl)cyclohexa-2,4-dien-1-yl]-2-cyclohex-2-en-1-yl-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 170065918 |
| Molecular Formula | C39H41N3 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | 4-[5-(4a,7,8,12,12a,12b-hexahydrotriphenylen-2-yl)cyclohexa-2,4-dien-1-yl]-2-cyclohex-2-en-1-yl-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | C1=CCC2C(=C1)C1=C(C=CCC1)C1C=CC(C3=CC=CC(C4N=C(c5ccccc5)NC(C5C=CCCC5)N4)C3)=CC12 |
| InChI | InChI=1S/C39H41N3/c1-3-12-26(13-4-1)37-40-38(27-14-5-2-6-15-27)42-39(41-37)30-17-11-16-28(24-30)29-22-23-35-33-20-8-7-18-31(33)32-19-9-10-21-34(32)36(35)25-29/h1,3-5,8-14,16-17,19-20,22-23,25,27,30,34-36,38-39,42H,2,6-7,15,18,21,24H2,(H,40,41) |
| InChIKey | FHDIJGXBDYFAFS-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|