C45H43N5 — CID 146428502
9-[3-(2-cyclohex-2-en-1-yl-3-methyl-6-phenyl-2,4-dihydro-1H-1,3,5-triazin-4-yl)-5-(3-phenylphenyl)-2-pyridinyl]-1,2,4b,8a-tetrahydrocarbazole (PubChem CID 146428502) has the molecular formula C45H43N5 and a molecular weight of 653.87 g/mol. Its IUPAC name is 9-[3-(2-cyclohex-2-en-1-yl-3-methyl-6-phenyl-2,4-dihydro-1H-1,3,5-triazin-4-yl)-5-(3-phenylphenyl)-2-pyridinyl]-1,2,4b,8a-tetrahydrocarbazole.
| Compound Name | 9-[3-(2-cyclohex-2-en-1-yl-3-methyl-6-phenyl-2,4-dihydro-1H-1,3,5-triazin-4-yl)-5-(3-phenylphenyl)-2-pyridinyl]-1,2,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 146428502 |
| Molecular Formula | C45H43N5 |
| Molecular Weight | 653.87 g/mol |
| Exact Mass | 653.35 |
| IUPAC Name | 9-[3-(2-cyclohex-2-en-1-yl-3-methyl-6-phenyl-2,4-dihydro-1H-1,3,5-triazin-4-yl)-5-(3-phenylphenyl)-2-pyridinyl]-1,2,4b,8a-tetrahydrocarbazole |
| SMILES | CN1C(c2cc(-c3cccc(-c4ccccc4)c3)cnc2N2C3=C(C=CCC3)C3C=CC=CC32)N=C(c2ccccc2)NC1C1C=CCCC1 |
| InChI | InChI=1S/C45H43N5/c1-49-43(33-20-9-4-10-21-33)47-42(32-18-7-3-8-19-32)48-45(49)39-29-36(35-23-15-22-34(28-35)31-16-5-2-6-17-31)30-46-44(39)50-40-26-13-11-24-37(40)38-25-12-14-27-41(38)50/h2-3,5-9,11-13,15-20,22-26,28-30,33,37,40,43,45H,4,10,14,21,27H2,1H3,(H,47,48) |
| InChIKey | KOFDKDJNLHEUPE-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.87 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|