C57H42N4 — CID 137208678
7-[3-(4b,8a-dihydrotriphenylen-2-yl)phenyl]-9-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]-1,2-dihydrocarbazole (PubChem CID 137208678) has the molecular formula C57H42N4 and a molecular weight of 782.99 g/mol. Its IUPAC name is 7-[3-(4b,8a-dihydrotriphenylen-2-yl)phenyl]-9-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]-1,2-dihydrocarbazole.
| Compound Name | 7-[3-(4b,8a-dihydrotriphenylen-2-yl)phenyl]-9-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 137208678 |
| Molecular Formula | C57H42N4 |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.34 |
| IUPAC Name | 7-[3-(4b,8a-dihydrotriphenylen-2-yl)phenyl]-9-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]-1,2-dihydrocarbazole |
| SMILES | C1=CC2c3ccccc3-c3cc(-c4cccc(-c5ccc6c7c(n(-c8cccc(C9=NC(c%10ccccc%10)=NC(c%10ccccc%10)N9)c8)c6c5)CCC=C7)c4)ccc3C2C=C1 |
| InChI | InChI=1S/C57H42N4/c1-3-15-37(16-4-1)55-58-56(38-17-5-2-6-18-38)60-57(59-55)43-21-14-22-44(34-43)61-53-28-12-11-27-50(53)51-32-30-42(36-54(51)61)40-20-13-19-39(33-40)41-29-31-49-47-25-8-7-23-45(47)46-24-9-10-26-48(46)52(49)35-41/h1-11,13-27,29-36,45,47,55H,12,28H2,(H,58,59,60) |
| InChIKey | PUNOJFKOMGRHLN-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |