C51H34N4OS — CID 163879853
9-[9-[9-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)dibenzofuran-1-yl]dibenzothiophen-2-yl]-1,2-dihydrocarbazole (PubChem CID 163879853) has the molecular formula C51H34N4OS and a molecular weight of 750.93 g/mol. Its IUPAC name is 9-[9-[9-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)dibenzofuran-1-yl]dibenzothiophen-2-yl]-1,2-dihydrocarbazole.
| Compound Name | 9-[9-[9-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)dibenzofuran-1-yl]dibenzothiophen-2-yl]-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 163879853 |
| Molecular Formula | C51H34N4OS |
| Molecular Weight | 750.93 g/mol |
| Exact Mass | 750.25 |
| IUPAC Name | 9-[9-[9-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)dibenzofuran-1-yl]dibenzothiophen-2-yl]-1,2-dihydrocarbazole |
| SMILES | C1=Cc2c(n(-c3ccc4sc5cccc(-c6cccc7oc8cccc(C9=NC(c%10ccccc%10)=NC(c%10ccccc%10)N9)c8c67)c5c4c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C51H34N4OS/c1-3-14-31(15-4-1)49-52-50(32-16-5-2-6-17-32)54-51(53-49)38-22-12-26-43-48(38)47-37(20-11-25-42(47)56-43)36-21-13-27-45-46(36)39-30-33(28-29-44(39)57-45)55-40-23-9-7-18-34(40)35-19-8-10-24-41(35)55/h1-9,11-23,25-30,49H,10,24H2,(H,52,53,54) |
| InChIKey | PSEKSGFNTRIPFN-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.93 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |