C50H43N4P — CID 163916476
[[4-[5-[6-(1,2,4b,8a-tetrahydrocarbazol-9-yl)-2-phenylpyrimidin-4-yl]cyclohexa-2,4-dien-1-yl]-3-phenyl-1,2-dihydroisoquinolin-1-yl]-phenylmethyl]phosphane (PubChem CID 163916476) has the molecular formula C50H43N4P and a molecular weight of 730.90 g/mol. Its IUPAC name is [[4-[5-[6-(1,2,4b,8a-tetrahydrocarbazol-9-yl)-2-phenylpyrimidin-4-yl]cyclohexa-2,4-dien-1-yl]-3-phenyl-1,2-dihydroisoquinolin-1-yl]-phenylmethyl]phosphane.
| Compound Name | [[4-[5-[6-(1,2,4b,8a-tetrahydrocarbazol-9-yl)-2-phenylpyrimidin-4-yl]cyclohexa-2,4-dien-1-yl]-3-phenyl-1,2-dihydroisoquinolin-1-yl]-phenylmethyl]phosphane |
|---|---|
| PubChem CID | 163916476 |
| Molecular Formula | C50H43N4P |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.32 |
| IUPAC Name | [[4-[5-[6-(1,2,4b,8a-tetrahydrocarbazol-9-yl)-2-phenylpyrimidin-4-yl]cyclohexa-2,4-dien-1-yl]-3-phenyl-1,2-dihydroisoquinolin-1-yl]-phenylmethyl]phosphane |
| SMILES | PC(c1ccccc1)C1NC(c2ccccc2)=C(C2C=CC=C(c3cc(N4C5=C(C=CCC5)C5C=CC=CC54)nc(-c4ccccc4)n3)C2)c2ccccc21 |
| InChI | InChI=1S/C50H43N4P/c55-49(34-19-6-2-7-20-34)48-41-28-11-10-27-40(41)46(47(53-48)33-17-4-1-5-18-33)37-24-16-23-36(31-37)42-32-45(52-50(51-42)35-21-8-3-9-22-35)54-43-29-14-12-25-38(43)39-26-13-15-30-44(39)54/h1-14,16-29,32,37-38,43,48-49,53H,15,30-31,55H2 |
| InChIKey | QWRSIFBNDUUMKS-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|