C46H34N6 — CID 142397095
14-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylphenyl]-1,14,16-triazapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2(7),3,9,11,15,17,19,21-octaene (PubChem CID 142397095) has the molecular formula C46H34N6 and a molecular weight of 670.82 g/mol. Its IUPAC name is 14-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylphenyl]-1,14,16-triazapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2(7),3,9,11,15,17,19,21-octaene.
| Compound Name | 14-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylphenyl]-1,14,16-triazapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2(7),3,9,11,15,17,19,21-octaene |
|---|---|
| PubChem CID | 142397095 |
| Molecular Formula | C46H34N6 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.28 |
| IUPAC Name | 14-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylphenyl]-1,14,16-triazapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2(7),3,9,11,15,17,19,21-octaene |
| SMILES | C1=CC2C3=C(C=CCC3)n3c(nc4ccccc43)N(c3cc(-c4ccccc4)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)C2C=C1 |
| InChI | InChI=1S/C46H34N6/c1-4-16-31(17-5-1)34-28-35(45-49-43(32-18-6-2-7-19-32)48-44(50-45)33-20-8-3-9-21-33)30-36(29-34)51-40-25-13-10-22-37(40)38-23-11-14-26-41(38)52-42-27-15-12-24-39(42)47-46(51)52/h1-10,12-22,24-30,37,40H,11,23H2 |
| InChIKey | HBVZKPKBSAXSGM-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |