C47H58N2 — CID 130349562
2-cyclohex-2-en-1-yl-4-[4-[7-(9,9-dimethyl-1,2,3,4,7,8-hexahydrofluoren-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]-6-phenyl-1,3-diazinane (PubChem CID 130349562) has the molecular formula C47H58N2 and a molecular weight of 651.00 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-yl-4-[4-[7-(9,9-dimethyl-1,2,3,4,7,8-hexahydrofluoren-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]-6-phenyl-1,3-diazinane.
| Compound Name | 2-cyclohex-2-en-1-yl-4-[4-[7-(9,9-dimethyl-1,2,3,4,7,8-hexahydrofluoren-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]-6-phenyl-1,3-diazinane |
|---|---|
| PubChem CID | 130349562 |
| Molecular Formula | C47H58N2 |
| Molecular Weight | 651.00 g/mol |
| Exact Mass | 650.46 |
| IUPAC Name | 2-cyclohex-2-en-1-yl-4-[4-[7-(9,9-dimethyl-1,2,3,4,7,8-hexahydrofluoren-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]-6-phenyl-1,3-diazinane |
| SMILES | CC1(C)C2=C(C=CCC2)C2=C1CC(C1=CC3=C(C4=CC=C(C5CC(c6ccccc6)NC(C6C=CCCC6)N5)CC4)CCCC3CC1)CC2 |
| InChI | InChI=1S/C47H58N2/c1-47(2)42-19-10-9-17-39(42)40-27-26-37(29-43(40)47)36-25-22-31-16-11-18-38(41(31)28-36)32-20-23-34(24-21-32)45-30-44(33-12-5-3-6-13-33)48-46(49-45)35-14-7-4-8-15-35/h3,5-7,9,12-14,17,20,23,28,31,35,37,44-46,48-49H,4,8,10-11,15-16,18-19,21-22,24-27,29-30H2,1-2H3 |
| InChIKey | JONNARWCJQGBKR-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.00 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|