C21H25N — CID 139550708
12,12-dimethyl-2,4a,5,5a,10,11,12b,12c-octahydro-1H-indeno[1,2-c]carbazole (PubChem CID 139550708) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 12,12-dimethyl-2,4a,5,5a,10,11,12b,12c-octahydro-1H-indeno[1,2-c]carbazole.
| Compound Name | 12,12-dimethyl-2,4a,5,5a,10,11,12b,12c-octahydro-1H-indeno[1,2-c]carbazole |
|---|---|
| PubChem CID | 139550708 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 12,12-dimethyl-2,4a,5,5a,10,11,12b,12c-octahydro-1H-indeno[1,2-c]carbazole |
| SMILES | CC1(C)C2=C(C=CCC2)C2=C1C1C(C=C2)NC2C=CCCC21 |
| InChI | InChI=1S/C21H25N/c1-21(2)16-9-5-3-7-13(16)14-11-12-18-19(20(14)21)15-8-4-6-10-17(15)22-18/h3,6-7,10-12,15,17-19,22H,4-5,8-9H2,1-2H3 |
| InChIKey | WIYCWAKXHPFXOV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|