C14H18O — CID 163639430
2,4a,7,8,9,9a-hexahydro-1H-fluoren-9-ylmethanol (PubChem CID 163639430) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2,4a,7,8,9,9a-hexahydro-1H-fluoren-9-ylmethanol.
| Compound Name | 2,4a,7,8,9,9a-hexahydro-1H-fluoren-9-ylmethanol |
|---|---|
| PubChem CID | 163639430 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2,4a,7,8,9,9a-hexahydro-1H-fluoren-9-ylmethanol |
| SMILES | OCC1C2=C(C=CCC2)C2C=CCCC21 |
| InChI | InChI=1S/C14H18O/c15-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-2,5-6,10,12,14-15H,3-4,7-9H2 |
| InChIKey | ICYCYHFURATFOC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|