C43H43N3 — CID 167154608
6-[3-[3-(1-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-1,3-diazetidin-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-yl]-2,4-diphenyl-1,2-dihydropyridine (PubChem CID 167154608) has the molecular formula C43H43N3 and a molecular weight of 601.84 g/mol. Its IUPAC name is 6-[3-[3-(1-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-1,3-diazetidin-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-yl]-2,4-diphenyl-1,2-dihydropyridine.
| Compound Name | 6-[3-[3-(1-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-1,3-diazetidin-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-yl]-2,4-diphenyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 167154608 |
| Molecular Formula | C43H43N3 |
| Molecular Weight | 601.84 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | 6-[3-[3-(1-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-1,3-diazetidin-2-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-yl]-2,4-diphenyl-1,2-dihydropyridine |
| SMILES | C1=CCCC(N2C(C3=CCCC=C3)NC2C2C=C(C3=CC(C4=CC(c5ccccc5)=CC(c5ccccc5)N4)CC=C3)C=CC2)=C1 |
| InChI | InChI=1S/C43H43N3/c1-5-15-31(16-6-1)38-29-40(32-17-7-2-8-18-32)44-41(30-38)36-23-13-21-34(27-36)35-22-14-24-37(28-35)43-45-42(33-19-9-3-10-20-33)46(43)39-25-11-4-12-26-39/h1-2,4-9,11,13-22,25,27-30,36-37,40,42-45H,3,10,12,23-24,26H2 |
| InChIKey | BULNVDOTOIGVRL-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.84 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |