C42H45NS — CID 129054696
3-[3-[6-(cyclohexa-1,5-dien-1-ylamino)-3-(5-cyclohexa-1,5-dien-1-ylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-6-phenylcyclohexa-2,4-diene-1-thiol (PubChem CID 129054696) has the molecular formula C42H45NS and a molecular weight of 595.90 g/mol. Its IUPAC name is 3-[3-[6-(cyclohexa-1,5-dien-1-ylamino)-3-(5-cyclohexa-1,5-dien-1-ylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-6-phenylcyclohexa-2,4-diene-1-thiol.
| Compound Name | 3-[3-[6-(cyclohexa-1,5-dien-1-ylamino)-3-(5-cyclohexa-1,5-dien-1-ylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-6-phenylcyclohexa-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 129054696 |
| Molecular Formula | C42H45NS |
| Molecular Weight | 595.90 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | 3-[3-[6-(cyclohexa-1,5-dien-1-ylamino)-3-(5-cyclohexa-1,5-dien-1-ylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-6-phenylcyclohexa-2,4-diene-1-thiol |
| SMILES | SC1C=C(C2CCC=C(C3=CC(C4=CCCC(C5=CCCC=C5)=C4)=CCC3NC3=CCCC=C3)C2)C=CC1c1ccccc1 |
| InChI | InChI=1S/C42H45NS/c44-42-29-36(22-24-39(42)31-14-6-2-7-15-31)34-18-11-19-37(27-34)40-28-35(23-25-41(40)43-38-20-8-3-9-21-38)33-17-10-16-32(26-33)30-12-4-1-5-13-30/h2,4,6-8,12-15,17,19-24,26,28-29,34,39,41-44H,1,3,5,9-11,16,18,25,27H2 |
| InChIKey | GIFCQYONMZIIQD-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.90 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|