C51H44N4S — CID 146428726
10-[2-[4,6-di(cyclohexa-1,5-dien-1-yl)-1,3,5-triazin-2-yl]-4-(3,6-diphenylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]-4a,10a-dihydrophenothiazine (PubChem CID 146428726) has the molecular formula C51H44N4S and a molecular weight of 745.01 g/mol. Its IUPAC name is 10-[2-[4,6-di(cyclohexa-1,5-dien-1-yl)-1,3,5-triazin-2-yl]-4-(3,6-diphenylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]-4a,10a-dihydrophenothiazine.
| Compound Name | 10-[2-[4,6-di(cyclohexa-1,5-dien-1-yl)-1,3,5-triazin-2-yl]-4-(3,6-diphenylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]-4a,10a-dihydrophenothiazine |
|---|---|
| PubChem CID | 146428726 |
| Molecular Formula | C51H44N4S |
| Molecular Weight | 745.01 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | 10-[2-[4,6-di(cyclohexa-1,5-dien-1-yl)-1,3,5-triazin-2-yl]-4-(3,6-diphenylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]-4a,10a-dihydrophenothiazine |
| SMILES | C1=CC2Sc3ccccc3N(C3=C(c4nc(C5=CCCC=C5)nc(C5=CCCC=C5)n4)C=C(C4=CC(c5ccccc5)=CCC4c4ccccc4)CC3)C2C=C1 |
| InChI | InChI=1S/C51H44N4S/c1-5-17-35(18-6-1)39-29-31-41(36-19-7-2-8-20-36)42(33-39)40-30-32-44(55-45-25-13-15-27-47(45)56-48-28-16-14-26-46(48)55)43(34-40)51-53-49(37-21-9-3-10-22-37)52-50(54-51)38-23-11-4-12-24-38/h1-2,5-9,11,13-29,33-34,41,45,47H,3-4,10,12,30-32H2 |
| InChIKey | RFPOMNWUTWSBCC-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.01 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |