C45H37N3 — CID 170381922
2-[2-[2-[(4aR,12aS)-4a,7,8,8b,12a,12b-hexahydrotriphenylen-2-yl]phenyl]phenyl]-4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazine (PubChem CID 170381922) has the molecular formula C45H37N3 and a molecular weight of 619.81 g/mol. Its IUPAC name is 2-[2-[2-[(4aR,12aS)-4a,7,8,8b,12a,12b-hexahydrotriphenylen-2-yl]phenyl]phenyl]-4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[2-[2-[(4aR,12aS)-4a,7,8,8b,12a,12b-hexahydrotriphenylen-2-yl]phenyl]phenyl]-4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170381922 |
| Molecular Formula | C45H37N3 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | 2-[2-[2-[(4aR,12aS)-4a,7,8,8b,12a,12b-hexahydrotriphenylen-2-yl]phenyl]phenyl]-4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazine |
| SMILES | C1=CC2C3=C(C=CCC3)[C@@H]3C=CC(c4ccccc4-c4ccccc4-c4nc(C5=CCCC=C5)nc(-c5ccccc5)n4)=CC3[C@@H]2C=C1 |
| InChI | InChI=1S/C45H37N3/c1-3-15-30(16-4-1)43-46-44(31-17-5-2-6-18-31)48-45(47-43)41-26-14-13-24-38(41)34-20-8-7-19-33(34)32-27-28-40-37-23-10-9-21-35(37)36-22-11-12-25-39(36)42(40)29-32/h1,3-5,7-8,10-20,22-29,36,39-40,42H,2,6,9,21H2/t36?,39-,40+,42?/m1/s1 |
| InChIKey | JPVUBUMVJLOBAD-CVDQVQOPSA-N |
| XLogP | 10.81 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |