C44H35N3 — CID 129171479
2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-[5-(2,3-dihydrofluoranthen-3-yl)-3-methylcyclohexa-1,5-dien-1-yl]-6-phenyl-1,3,5-triazine (PubChem CID 129171479) has the molecular formula C44H35N3 and a molecular weight of 605.79 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-[5-(2,3-dihydrofluoranthen-3-yl)-3-methylcyclohexa-1,5-dien-1-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-[5-(2,3-dihydrofluoranthen-3-yl)-3-methylcyclohexa-1,5-dien-1-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 129171479 |
| Molecular Formula | C44H35N3 |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-4-[5-(2,3-dihydrofluoranthen-3-yl)-3-methylcyclohexa-1,5-dien-1-yl]-6-phenyl-1,3,5-triazine |
| SMILES | CC1C=C(c2nc(-c3ccccc3)nc(-c3ccc(C4=CCCC=C4)cc3)n2)C=C(C2CC=C3c4ccccc4-c4cccc2c43)C1 |
| InChI | InChI=1S/C44H35N3/c1-28-25-33(35-23-24-40-37-16-9-8-15-36(37)39-18-10-17-38(35)41(39)40)27-34(26-28)44-46-42(31-13-6-3-7-14-31)45-43(47-44)32-21-19-30(20-22-32)29-11-4-2-5-12-29/h3-4,6-22,24,26-28,35H,2,5,23,25H2,1H3 |
| InChIKey | GIYXQGRYCOPHIY-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |