C34H48N4O5 — CID 166958107
5-[4-[[[(2R)-2,3-dihydroxypropyl]amino]methyl]phenyl]-3-[ethyl(oxan-4-yl)amino]-N-[(2E,4Z)-5-formamido-2,3-dimethylhexa-2,4-dienyl]-2-methylbenzamide (PubChem CID 166958107) has the molecular formula C34H48N4O5 and a molecular weight of 592.78 g/mol. Its IUPAC name is 5-[4-[[[(2R)-2,3-dihydroxypropyl]amino]methyl]phenyl]-3-[ethyl(oxan-4-yl)amino]-N-[(2E,4Z)-5-formamido-2,3-dimethylhexa-2,4-dienyl]-2-methylbenzamide.
| Compound Name | 5-[4-[[[(2R)-2,3-dihydroxypropyl]amino]methyl]phenyl]-3-[ethyl(oxan-4-yl)amino]-N-[(2E,4Z)-5-formamido-2,3-dimethylhexa-2,4-dienyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 166958107 |
| Molecular Formula | C34H48N4O5 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | 5-[4-[[[(2R)-2,3-dihydroxypropyl]amino]methyl]phenyl]-3-[ethyl(oxan-4-yl)amino]-N-[(2E,4Z)-5-formamido-2,3-dimethylhexa-2,4-dienyl]-2-methylbenzamide |
| SMILES | CCN(c1cc(-c2ccc(CNC[C@@H](O)CO)cc2)cc(C(=O)NC/C(C)=C(C)/C=C(/C)NC=O)c1C)C1CCOCC1 |
| InChI | InChI=1S/C34H48N4O5/c1-6-38(30-11-13-43-14-12-30)33-17-29(28-9-7-27(8-10-28)19-35-20-31(41)21-39)16-32(26(33)5)34(42)36-18-24(3)23(2)15-25(4)37-22-40/h7-10,15-17,22,30-31,35,39,41H,6,11-14,18-21H2,1-5H3,(H,36,42)(H,37,40)/b24-23+,25-15-/t31-/m1/s1 |
| InChIKey | OAHQXWQSKLGVGK-OWDZQHNASA-N |
| XLogP | 3.83 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|