C24H29NO4 — CID 145379558
methyl 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(oxiran-2-yl)phenyl]benzoate (PubChem CID 145379558) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is methyl 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(oxiran-2-yl)phenyl]benzoate.
| Compound Name | methyl 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(oxiran-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 145379558 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | methyl 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(oxiran-2-yl)phenyl]benzoate |
| SMILES | CCN(c1cc(-c2ccc(C3CO3)cc2)cc(C(=O)OC)c1C)C1CCOCC1 |
| InChI | InChI=1S/C24H29NO4/c1-4-25(20-9-11-28-12-10-20)22-14-19(13-21(16(22)2)24(26)27-3)17-5-7-18(8-6-17)23-15-29-23/h5-8,13-14,20,23H,4,9-12,15H2,1-3H3 |
| InChIKey | LMKWEZAECBUADP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|