C23H33NO5 — CID 157479889
methyl 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 157479889) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 157479889 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | methyl 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCN(c1cc(C=CC(=O)OC(C)(C)C)cc(C(=O)OC)c1C)C1CCOCC1 |
| InChI | InChI=1S/C23H33NO5/c1-7-24(18-10-12-28-13-11-18)20-15-17(8-9-21(25)29-23(3,4)5)14-19(16(20)2)22(26)27-6/h8-9,14-15,18H,7,10-13H2,1-6H3 |
| InChIKey | PULYKYMDUJIGDI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|