C20H27NO4 — CID 158612790
methyl 3-[ethyl(oxan-4-yl)amino]-5-(2-formylcyclopropyl)-2-methylbenzoate (PubChem CID 158612790) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is methyl 3-[ethyl(oxan-4-yl)amino]-5-(2-formylcyclopropyl)-2-methylbenzoate.
| Compound Name | methyl 3-[ethyl(oxan-4-yl)amino]-5-(2-formylcyclopropyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 158612790 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | methyl 3-[ethyl(oxan-4-yl)amino]-5-(2-formylcyclopropyl)-2-methylbenzoate |
| SMILES | CCN(c1cc(C2CC2C=O)cc(C(=O)OC)c1C)C1CCOCC1 |
| InChI | InChI=1S/C20H27NO4/c1-4-21(16-5-7-25-8-6-16)19-11-14(18-10-15(18)12-22)9-17(13(19)2)20(23)24-3/h9,11-12,15-16,18H,4-8,10H2,1-3H3 |
| InChIKey | JNGABAUVJSZZQD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|