C17H24BrNO3 — CID 90273001
ethyl 5-bromo-3-[ethyl(oxan-4-yl)amino]-2-methylbenzoate (PubChem CID 90273001) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is ethyl 5-bromo-3-[ethyl(oxan-4-yl)amino]-2-methylbenzoate.
| Compound Name | ethyl 5-bromo-3-[ethyl(oxan-4-yl)amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 90273001 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | ethyl 5-bromo-3-[ethyl(oxan-4-yl)amino]-2-methylbenzoate |
| SMILES | CCOC(=O)c1cc(Br)cc(N(CC)C2CCOCC2)c1C |
| InChI | InChI=1S/C17H24BrNO3/c1-4-19(14-6-8-21-9-7-14)16-11-13(18)10-15(12(16)3)17(20)22-5-2/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | PZLWYHYDVVAURR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |