C24H34N2O4 — CID 90150901
methyl 3-[ethyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]-5-ethynyl-2-methylbenzoate (PubChem CID 90150901) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is methyl 3-[ethyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]-5-ethynyl-2-methylbenzoate.
| Compound Name | methyl 3-[ethyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]-5-ethynyl-2-methylbenzoate |
|---|---|
| PubChem CID | 90150901 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | methyl 3-[ethyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]-5-ethynyl-2-methylbenzoate |
| SMILES | C#Cc1cc(C(=O)OC)c(C)c(N(CC)C2CCC(NC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C24H34N2O4/c1-8-17-14-20(22(27)29-7)16(3)21(15-17)26(9-2)19-12-10-18(11-13-19)25-23(28)30-24(4,5)6/h1,14-15,18-19H,9-13H2,2-7H3,(H,25,28) |
| InChIKey | SFYWFNYZOGAUOQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|