C42H60Br2N2O8 — CID 161298109
methyl 5-bromo-2-methyl-3-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl]benzoate (PubChem CID 161298109) has the molecular formula C42H60Br2N2O8 and a molecular weight of 880.76 g/mol. Its IUPAC name is methyl 5-bromo-2-methyl-3-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl]benzoate.
| Compound Name | methyl 5-bromo-2-methyl-3-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl]benzoate |
|---|---|
| PubChem CID | 161298109 |
| Molecular Formula | C42H60Br2N2O8 |
| Molecular Weight | 880.76 g/mol |
| Exact Mass | 878.27 |
| IUPAC Name | methyl 5-bromo-2-methyl-3-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl]benzoate |
| SMILES | COC(=O)c1cc(Br)cc(CC2CCC(NC(=O)OC(C)(C)C)CC2)c1C.COC(=O)c1cc(Br)cc(CC2CCC(NC(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/2C21H30BrNO4/c2*1-13-15(11-16(22)12-18(13)19(24)26-5)10-14-6-8-17(9-7-14)23-20(25)27-21(2,3)4/h2*11-12,14,17H,6-10H2,1-5H3,(H,23,25) |
| InChIKey | VHGAUNHSUCOORN-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.76 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|