C15H27ClN2O3 — CID 66564667
tert-butyl N-[4-[(2-chloroacetyl)-ethylamino]cyclohexyl]carbamate (PubChem CID 66564667) has the molecular formula C15H27ClN2O3 and a molecular weight of 318.85 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-chloroacetyl)-ethylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-chloroacetyl)-ethylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 66564667 |
| Molecular Formula | C15H27ClN2O3 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl N-[4-[(2-chloroacetyl)-ethylamino]cyclohexyl]carbamate |
| SMILES | CCN(C(=O)CCl)C1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H27ClN2O3/c1-5-18(13(19)10-16)12-8-6-11(7-9-12)17-14(20)21-15(2,3)4/h11-12H,5-10H2,1-4H3,(H,17,20) |
| InChIKey | CXQZQPFYUXEBTP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|