C26H34N2O4 — CID 175138234
3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(morpholin-2-ylmethyl)phenyl]benzoic acid (PubChem CID 175138234) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(morpholin-2-ylmethyl)phenyl]benzoic acid.
| Compound Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(morpholin-2-ylmethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 175138234 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(morpholin-2-ylmethyl)phenyl]benzoic acid |
| SMILES | CCN(c1cc(-c2ccc(CC3CNCCO3)cc2)cc(C(=O)O)c1C)C1CCOCC1 |
| InChI | InChI=1S/C26H34N2O4/c1-3-28(22-8-11-31-12-9-22)25-16-21(15-24(18(25)2)26(29)30)20-6-4-19(5-7-20)14-23-17-27-10-13-32-23/h4-7,15-16,22-23,27H,3,8-14,17H2,1-2H3,(H,29,30) |
| InChIKey | MOHSIQYVMLZCNT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |