C30H43N5O2 — CID 175906976
3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(4-piperidin-4-ylpiperazin-1-yl)phenyl]benzamide (PubChem CID 175906976) has the molecular formula C30H43N5O2 and a molecular weight of 505.71 g/mol. Its IUPAC name is 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(4-piperidin-4-ylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(4-piperidin-4-ylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 175906976 |
| Molecular Formula | C30H43N5O2 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(4-piperidin-4-ylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CCN(c1cc(-c2ccc(N3CCN(C4CCNCC4)CC3)cc2)cc(C(N)=O)c1C)C1CCOCC1 |
| InChI | InChI=1S/C30H43N5O2/c1-3-35(27-10-18-37-19-11-27)29-21-24(20-28(22(29)2)30(31)36)23-4-6-25(7-5-23)33-14-16-34(17-15-33)26-8-12-32-13-9-26/h4-7,20-21,26-27,32H,3,8-19H2,1-2H3,(H2,31,36) |
| InChIKey | LQTUTKYCPAUKRT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |