C33H49N3O4 — CID 130276635
3-[ethyl(oxan-4-yl)amino]-5-[4-(2-methoxyethoxy)phenyl]-2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 130276635) has the molecular formula C33H49N3O4 and a molecular weight of 551.77 g/mol. Its IUPAC name is 3-[ethyl(oxan-4-yl)amino]-5-[4-(2-methoxyethoxy)phenyl]-2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 3-[ethyl(oxan-4-yl)amino]-5-[4-(2-methoxyethoxy)phenyl]-2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 130276635 |
| Molecular Formula | C33H49N3O4 |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.37 |
| IUPAC Name | 3-[ethyl(oxan-4-yl)amino]-5-[4-(2-methoxyethoxy)phenyl]-2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CCN(c1cc(-c2ccc(OCCOC)cc2)cc(C(=O)NC2CC(C)(C)NC(C)(C)C2)c1C)C1CCOCC1 |
| InChI | InChI=1S/C33H49N3O4/c1-8-36(27-13-15-39-16-14-27)30-20-25(24-9-11-28(12-10-24)40-18-17-38-7)19-29(23(30)2)31(37)34-26-21-32(3,4)35-33(5,6)22-26/h9-12,19-20,26-27,35H,8,13-18,21-22H2,1-7H3,(H,34,37) |
| InChIKey | PPNAAKISBJMDRT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|