C25H34N2O4 — CID 137497076
3-[(4-aminocyclohexyl)-ethylamino]-5-[4-(2-methoxyethoxy)phenyl]-2-methylbenzoic acid (PubChem CID 137497076) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-[(4-aminocyclohexyl)-ethylamino]-5-[4-(2-methoxyethoxy)phenyl]-2-methylbenzoic acid.
| Compound Name | 3-[(4-aminocyclohexyl)-ethylamino]-5-[4-(2-methoxyethoxy)phenyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 137497076 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 3-[(4-aminocyclohexyl)-ethylamino]-5-[4-(2-methoxyethoxy)phenyl]-2-methylbenzoic acid |
| SMILES | CCN(c1cc(-c2ccc(OCCOC)cc2)cc(C(=O)O)c1C)C1CCC(N)CC1 |
| InChI | InChI=1S/C25H34N2O4/c1-4-27(21-9-7-20(26)8-10-21)24-16-19(15-23(17(24)2)25(28)29)18-5-11-22(12-6-18)31-14-13-30-3/h5-6,11-12,15-16,20-21H,4,7-10,13-14,26H2,1-3H3,(H,28,29) |
| InChIKey | SDXSJPHHXAISFA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|