C27H38N2O4 — CID 90238093
3-[[4-(dimethylamino)cyclohexyl]-ethylamino]-5-[4-(2-methoxyethoxy)phenyl]-2-methylbenzoic acid (PubChem CID 90238093) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)cyclohexyl]-ethylamino]-5-[4-(2-methoxyethoxy)phenyl]-2-methylbenzoic acid.
| Compound Name | 3-[[4-(dimethylamino)cyclohexyl]-ethylamino]-5-[4-(2-methoxyethoxy)phenyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 90238093 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 3-[[4-(dimethylamino)cyclohexyl]-ethylamino]-5-[4-(2-methoxyethoxy)phenyl]-2-methylbenzoic acid |
| SMILES | CCN(c1cc(-c2ccc(OCCOC)cc2)cc(C(=O)O)c1C)C1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C27H38N2O4/c1-6-29(23-11-9-22(10-12-23)28(3)4)26-18-21(17-25(19(26)2)27(30)31)20-7-13-24(14-8-20)33-16-15-32-5/h7-8,13-14,17-18,22-23H,6,9-12,15-16H2,1-5H3,(H,30,31) |
| InChIKey | YAICXFFWTVEHDW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|