C22H25NO6S — CID 166958775
3-[3-[[(2-hydroxyphenyl)sulfonylamino]methyl]-4-methylphenyl]-2,2-dimethyl-3-prop-2-ynoxypropanoic acid (PubChem CID 166958775) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is 3-[3-[[(2-hydroxyphenyl)sulfonylamino]methyl]-4-methylphenyl]-2,2-dimethyl-3-prop-2-ynoxypropanoic acid.
| Compound Name | 3-[3-[[(2-hydroxyphenyl)sulfonylamino]methyl]-4-methylphenyl]-2,2-dimethyl-3-prop-2-ynoxypropanoic acid |
|---|---|
| PubChem CID | 166958775 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 3-[3-[[(2-hydroxyphenyl)sulfonylamino]methyl]-4-methylphenyl]-2,2-dimethyl-3-prop-2-ynoxypropanoic acid |
| SMILES | C#CCOC(c1ccc(C)c(CNS(=O)(=O)c2ccccc2O)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C22H25NO6S/c1-5-12-29-20(22(3,4)21(25)26)16-11-10-15(2)17(13-16)14-23-30(27,28)19-9-7-6-8-18(19)24/h1,6-11,13,20,23-24H,12,14H2,2-4H3,(H,25,26) |
| InChIKey | CNZNOQDBHBVTLL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|