C24H26N2O2 — CID 166959788
(E)-N-methyl-2-[3-methyl-2-[[(E)-3-(4-methylphenyl)prop-2-ynylideneamino]oxymethyl]phenyl]pent-2-enamide (PubChem CID 166959788) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (E)-N-methyl-2-[3-methyl-2-[[(E)-3-(4-methylphenyl)prop-2-ynylideneamino]oxymethyl]phenyl]pent-2-enamide.
| Compound Name | (E)-N-methyl-2-[3-methyl-2-[[(E)-3-(4-methylphenyl)prop-2-ynylideneamino]oxymethyl]phenyl]pent-2-enamide |
|---|---|
| PubChem CID | 166959788 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (E)-N-methyl-2-[3-methyl-2-[[(E)-3-(4-methylphenyl)prop-2-ynylideneamino]oxymethyl]phenyl]pent-2-enamide |
| SMILES | CC/C=C(/C(=O)NC)c1cccc(C)c1CO/N=C/C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C24H26N2O2/c1-5-8-22(24(27)25-4)21-11-6-9-19(3)23(21)17-28-26-16-7-10-20-14-12-18(2)13-15-20/h6,8-9,11-16H,5,17H2,1-4H3,(H,25,27)/b22-8+,26-16+ |
| InChIKey | DQSCVBNEWJZUGX-XXSOBTTFSA-N |
| XLogP | 4.40 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|