C16H30N4O7 — CID 166964103
(2S)-5-[[amino(hydroxy)methyl]amino]-2-[[(2S)-2-(4-carboxybutanoylamino)-3-methylbutanoyl]amino]pentanoic acid (PubChem CID 166964103) has the molecular formula C16H30N4O7 and a molecular weight of 390.44 g/mol. Its IUPAC name is (2S)-5-[[amino(hydroxy)methyl]amino]-2-[[(2S)-2-(4-carboxybutanoylamino)-3-methylbutanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-[[amino(hydroxy)methyl]amino]-2-[[(2S)-2-(4-carboxybutanoylamino)-3-methylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 166964103 |
| Molecular Formula | C16H30N4O7 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2S)-5-[[amino(hydroxy)methyl]amino]-2-[[(2S)-2-(4-carboxybutanoylamino)-3-methylbutanoyl]amino]pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCC(=O)O)C(=O)N[C@@H](CCCNC(N)O)C(=O)O |
| InChI | InChI=1S/C16H30N4O7/c1-9(2)13(20-11(21)6-3-7-12(22)23)14(24)19-10(15(25)26)5-4-8-18-16(17)27/h9-10,13,16,18,27H,3-8,17H2,1-2H3,(H,19,24)(H,20,21)(H,22,23)(H,25,26)/t10-,13-,16?/m0/s1 |
| InChIKey | BRMJXVPXAABSOX-MRAATUQHSA-N |
| XLogP | -1.44 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|