C31H54N2O3 — CID 166965627
3-(dimethylamino)-N-[(1R,6R,8R,9S,13S,16S,18R)-6-[(3S)-4-hydroxy-3-methylbutyl]-9,13-dimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]propanamide (PubChem CID 166965627) has the molecular formula C31H54N2O3 and a molecular weight of 502.78 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[(1R,6R,8R,9S,13S,16S,18R)-6-[(3S)-4-hydroxy-3-methylbutyl]-9,13-dimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]propanamide.
| Compound Name | 3-(dimethylamino)-N-[(1R,6R,8R,9S,13S,16S,18R)-6-[(3S)-4-hydroxy-3-methylbutyl]-9,13-dimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]propanamide |
|---|---|
| PubChem CID | 166965627 |
| Molecular Formula | C31H54N2O3 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.41 |
| IUPAC Name | 3-(dimethylamino)-N-[(1R,6R,8R,9S,13S,16S,18R)-6-[(3S)-4-hydroxy-3-methylbutyl]-9,13-dimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]propanamide |
| SMILES | C[C@H](CO)CC[C@@H]1C[C@H]2C(CC3[C@@H]4CC[C@@H]5C[C@@H](NC(=O)CCN(C)C)CC[C@]5(C)C4CC[C@@]32C)O1 |
| InChI | InChI=1S/C31H54N2O3/c1-20(19-34)6-8-23-17-27-28(36-23)18-26-24-9-7-21-16-22(32-29(35)12-15-33(4)5)10-13-30(21,2)25(24)11-14-31(26,27)3/h20-28,34H,6-19H2,1-5H3,(H,32,35)/t20-,21+,22-,23+,24+,25?,26?,27-,28?,30-,31-/m0/s1 |
| InChIKey | ASJSKECWFWVXQS-UXVSKQJOSA-N |
| XLogP | 5.26 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |