C27H46O2 — CID 166965642
(2S)-2-methyl-4-[(1R,6R,8R,9S,13S,18R)-9,13,16-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]butan-1-ol (PubChem CID 166965642) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is (2S)-2-methyl-4-[(1R,6R,8R,9S,13S,18R)-9,13,16-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]butan-1-ol.
| Compound Name | (2S)-2-methyl-4-[(1R,6R,8R,9S,13S,18R)-9,13,16-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]butan-1-ol |
|---|---|
| PubChem CID | 166965642 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | (2S)-2-methyl-4-[(1R,6R,8R,9S,13S,18R)-9,13,16-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]butan-1-ol |
| SMILES | CC1CC[C@]2(C)C3CC[C@@]4(C)C(CC5O[C@H](CC[C@H](C)CO)C[C@@H]54)[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C27H46O2/c1-17-9-11-26(3)19(13-17)6-8-21-22(26)10-12-27(4)23(21)15-25-24(27)14-20(29-25)7-5-18(2)16-28/h17-25,28H,5-16H2,1-4H3/t17?,18-,19+,20+,21+,22?,23?,24-,25?,26-,27-/m0/s1 |
| InChIKey | GHNGJRNNYRPNNP-QNKYHEPUSA-N |
| XLogP | 6.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |