C19H34O3 — CID 166966633
2-hydroxy-4-(4-methylcycloundecyl)cyclohexane-1-carboxylic acid (PubChem CID 166966633) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-hydroxy-4-(4-methylcycloundecyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-hydroxy-4-(4-methylcycloundecyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166966633 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 2-hydroxy-4-(4-methylcycloundecyl)cyclohexane-1-carboxylic acid |
| SMILES | CC1CCCCCCCC(C2CCC(C(=O)O)C(O)C2)CC1 |
| InChI | InChI=1S/C19H34O3/c1-14-7-5-3-2-4-6-8-15(10-9-14)16-11-12-17(19(21)22)18(20)13-16/h14-18,20H,2-13H2,1H3,(H,21,22) |
| InChIKey | FNGSKVJQSXJCNN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |