C55H32N10 — CID 166968161
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridinyl]phenyl]carbazole-3,6-dicarbonitrile (PubChem CID 166968161) has the molecular formula C55H32N10 and a molecular weight of 832.93 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridinyl]phenyl]carbazole-3,6-dicarbonitrile.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridinyl]phenyl]carbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 166968161 |
| Molecular Formula | C55H32N10 |
| Molecular Weight | 832.93 g/mol |
| Exact Mass | 832.28 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridinyl]phenyl]carbazole-3,6-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1cc(C#N)ccc1n2-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1ccncc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C55H32N10/c56-32-35-21-24-47-43(29-35)44-30-36(33-57)22-25-48(44)65(47)49-26-23-41(54-61-50(37-13-5-1-6-14-37)59-51(62-54)38-15-7-2-8-16-38)31-45(49)42-27-28-58-34-46(42)55-63-52(39-17-9-3-10-18-39)60-53(64-55)40-19-11-4-12-20-40/h1-31,34H |
| InChIKey | QOGDDROVSAFADF-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.93 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |