C54H28N10 — CID 156679371
9-[3-[2-(3,6-diisocyanocarbazol-9-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-pyridinyl]carbazole-3,6-dicarbonitrile (PubChem CID 156679371) has the molecular formula C54H28N10 and a molecular weight of 816.89 g/mol. Its IUPAC name is 9-[3-[2-(3,6-diisocyanocarbazol-9-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-pyridinyl]carbazole-3,6-dicarbonitrile.
| Compound Name | 9-[3-[2-(3,6-diisocyanocarbazol-9-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-pyridinyl]carbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 156679371 |
| Molecular Formula | C54H28N10 |
| Molecular Weight | 816.89 g/mol |
| Exact Mass | 816.25 |
| IUPAC Name | 9-[3-[2-(3,6-diisocyanocarbazol-9-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-pyridinyl]carbazole-3,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc([N+]#[C-])ccc1n2-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-c1cnccc1-n1c2ccc(C#N)cc2c2cc(C#N)ccc21 |
| InChI | InChI=1S/C54H28N10/c1-57-38-16-21-48-43(28-38)44-29-39(58-2)17-22-49(44)64(48)51-27-37(54-61-52(35-9-5-3-6-10-35)60-53(62-54)36-11-7-4-8-12-36)15-18-40(51)45-32-59-24-23-50(45)63-46-19-13-33(30-55)25-41(46)42-26-34(31-56)14-20-47(42)63/h3-29,32H |
| InChIKey | GZAPPVDPCQDOLF-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.89 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|