C62H32N10 — CID 162472052
9-[4-[2-(3-cyano-6-isocyanocarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(4-cyanophenyl)phenyl]carbazole-3,6-dicarbonitrile (PubChem CID 162472052) has the molecular formula C62H32N10 and a molecular weight of 917.01 g/mol. Its IUPAC name is 9-[4-[2-(3-cyano-6-isocyanocarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(4-cyanophenyl)phenyl]carbazole-3,6-dicarbonitrile.
| Compound Name | 9-[4-[2-(3-cyano-6-isocyanocarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(4-cyanophenyl)phenyl]carbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 162472052 |
| Molecular Formula | C62H32N10 |
| Molecular Weight | 917.01 g/mol |
| Exact Mass | 916.28 |
| IUPAC Name | 9-[4-[2-(3-cyano-6-isocyanocarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(4-cyanophenyl)phenyl]carbazole-3,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(C#N)ccc1n2-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1ccc(-n2c3ccc(C#N)cc3c3cc(C#N)ccc32)c(-c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C62H32N10/c1-67-47-21-27-59-53(33-47)52-30-41(37-66)16-24-58(52)72(59)55-26-20-46(62-69-60(43-8-4-2-5-9-43)68-61(70-62)44-10-6-3-7-11-44)32-49(55)45-19-25-54(48(31-45)42-17-12-38(34-63)13-18-42)71-56-22-14-39(35-64)28-50(56)51-29-40(36-65)15-23-57(51)71/h2-33H |
| InChIKey | HJJUNELYDMCHOJ-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 148.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.01 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|