C62H32N10 — CID 153432138
9-[4-(4-cyanophenyl)-2-[3-(3,6-diisocyanocarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile (PubChem CID 153432138) has the molecular formula C62H32N10 and a molecular weight of 917.01 g/mol. Its IUPAC name is 9-[4-(4-cyanophenyl)-2-[3-(3,6-diisocyanocarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile.
| Compound Name | 9-[4-(4-cyanophenyl)-2-[3-(3,6-diisocyanocarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 153432138 |
| Molecular Formula | C62H32N10 |
| Molecular Weight | 917.01 g/mol |
| Exact Mass | 916.28 |
| IUPAC Name | 9-[4-(4-cyanophenyl)-2-[3-(3,6-diisocyanocarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(C#N)ccc1n2-c1ccc(-c2ccc(C#N)cc2)cc1-c1cccc(-n2c3ccc([N+]#[C-])cc3c3cc([N+]#[C-])ccc32)c1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C62H32N10/c1-65-44-23-28-55-50(33-44)48-31-39(37-64)19-26-53(48)71(55)54-27-22-43(40-20-17-38(36-63)18-21-40)32-49(54)47-15-10-16-58(72-56-29-24-45(66-2)34-51(56)52-35-46(67-3)25-30-57(52)72)59(47)62-69-60(41-11-6-4-7-12-41)68-61(70-62)42-13-8-5-9-14-42/h4-35H |
| InChIKey | NQWKCCPBIKILAJ-UHFFFAOYSA-N |
| XLogP | 15.80 |
| TPSA | 109.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.01 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|